C20H14N2O3 — CID 169335271
5-[3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]furan-2-carbaldehyde (PubChem CID 169335271) has the molecular formula C20H14N2O3 and a molecular weight of 330.34 g/mol. Its IUPAC name is 5-[3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]furan-2-carbaldehyde.
| Compound Name | 5-[3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169335271 |
| Molecular Formula | C20H14N2O3 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 5-[3-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]phenyl]furan-2-carbaldehyde |
| SMILES | Cc1ccc(-c2nnc(-c3cccc(-c4ccc(C=O)o4)c3)o2)cc1 |
| InChI | InChI=1S/C20H14N2O3/c1-13-5-7-14(8-6-13)19-21-22-20(25-19)16-4-2-3-15(11-16)18-10-9-17(12-23)24-18/h2-12H,1H3 |
| InChIKey | SKAKQPRVJHCERG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 69.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|