C19H14N2O2 — CID 169334844
5-[3-(6-methyl-1H-benzimidazol-2-yl)phenyl]furan-2-carbaldehyde (PubChem CID 169334844) has the molecular formula C19H14N2O2 and a molecular weight of 302.33 g/mol. Its IUPAC name is 5-[3-(6-methyl-1H-benzimidazol-2-yl)phenyl]furan-2-carbaldehyde.
| Compound Name | 5-[3-(6-methyl-1H-benzimidazol-2-yl)phenyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169334844 |
| Molecular Formula | C19H14N2O2 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 5-[3-(6-methyl-1H-benzimidazol-2-yl)phenyl]furan-2-carbaldehyde |
| SMILES | Cc1ccc2nc(-c3cccc(-c4ccc(C=O)o4)c3)[nH]c2c1 |
| InChI | InChI=1S/C19H14N2O2/c1-12-5-7-16-17(9-12)21-19(20-16)14-4-2-3-13(10-14)18-8-6-15(11-22)23-18/h2-11H,1H3,(H,20,21) |
| InChIKey | HTSOOAIMJMCDNH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|