C13H8N2O3S — CID 169334067
5-[3-(1,3,4-thiadiazol-2-yloxy)phenyl]furan-2-carbaldehyde (PubChem CID 169334067) has the molecular formula C13H8N2O3S and a molecular weight of 272.29 g/mol. Its IUPAC name is 5-[3-(1,3,4-thiadiazol-2-yloxy)phenyl]furan-2-carbaldehyde.
| Compound Name | 5-[3-(1,3,4-thiadiazol-2-yloxy)phenyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169334067 |
| Molecular Formula | C13H8N2O3S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 5-[3-(1,3,4-thiadiazol-2-yloxy)phenyl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2cccc(Oc3nncs3)c2)o1 |
| InChI | InChI=1S/C13H8N2O3S/c16-7-11-4-5-12(17-11)9-2-1-3-10(6-9)18-13-15-14-8-19-13/h1-8H |
| InChIKey | MVTRDSREQWUBEM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|