C8H5N5OS — CID 169325618
2-(3-azidophenoxy)-1,3,4-thiadiazole (PubChem CID 169325618) has the molecular formula C8H5N5OS and a molecular weight of 219.23 g/mol. Its IUPAC name is 2-(3-azidophenoxy)-1,3,4-thiadiazole.
| Compound Name | 2-(3-azidophenoxy)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 169325618 |
| Molecular Formula | C8H5N5OS |
| Molecular Weight | 219.23 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | 2-(3-azidophenoxy)-1,3,4-thiadiazole |
| SMILES | [N-]=[N+]=Nc1cccc(Oc2nncs2)c1 |
| InChI | InChI=1S/C8H5N5OS/c9-13-11-6-2-1-3-7(4-6)14-8-12-10-5-15-8/h1-5H |
| InChIKey | YIACJMAGJIQMEG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 83.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|