C8H5ClN2OS — CID 134106429
2-(4-chlorophenoxy)-1,3,4-thiadiazole (PubChem CID 134106429) has the molecular formula C8H5ClN2OS and a molecular weight of 212.66 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-1,3,4-thiadiazole.
| Compound Name | 2-(4-chlorophenoxy)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 134106429 |
| Molecular Formula | C8H5ClN2OS |
| Molecular Weight | 212.66 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | 2-(4-chlorophenoxy)-1,3,4-thiadiazole |
| SMILES | Clc1ccc(Oc2nncs2)cc1 |
| InChI | InChI=1S/C8H5ClN2OS/c9-6-1-3-7(4-2-6)12-8-11-10-5-13-8/h1-5H |
| InChIKey | PDPLDUMSNBOQQH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.66 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |