About 2-azidopyrene
2-azidopyrene (PubChem CID 14121488) has the molecular formula C16H9N3
and a molecular weight of 243.27 g/mol. Its IUPAC name is 2-azidopyrene.
Molecular Properties
| Compound Name | 2-azidopyrene |
| PubChem CID | 14121488 |
| Molecular Formula | C16H9N3 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 2-azidopyrene |
| SMILES | [N-]=[N+]=Nc1cc2ccc3cccc4ccc(c1)c2c34 |
| InChI | InChI=1S/C16H9N3/c17-19-18-14-8-12-6-4-10-2-1-3-11-5-7-13(9-14)16(12)15(10)11/h1-9H |
| InChIKey | MTJKLQLBMIKELJ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-azidopyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azidopyrene?
The IUPAC name of 2-azidopyrene (CID 14121488) is 2-azidopyrene.
What is the SMILES notation for 2-azidopyrene?
The canonical SMILES for 2-azidopyrene is [N-]=[N+]=Nc1cc2ccc3cccc4ccc(c1)c2c34.
What is the InChIKey of 2-azidopyrene?
The InChIKey is MTJKLQLBMIKELJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9N3/c17-19-18-14-8-12-6-4-10-2-1-3-11-5-7-13(9-14)16(12)15(10)11/h1-9H.
What are the key properties of 2-azidopyrene?
2-azidopyrene has a molecular weight of 243.27 g/mol, XLogP of 5.53, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azidopyrene is sourced from PubChem (CID 14121488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).