C15H11NO4 — CID 169333937
5-[3-(2,5-dioxopyrrolidin-1-yl)phenyl]furan-2-carbaldehyde (PubChem CID 169333937) has the molecular formula C15H11NO4 and a molecular weight of 269.26 g/mol. Its IUPAC name is 5-[3-(2,5-dioxopyrrolidin-1-yl)phenyl]furan-2-carbaldehyde.
| Compound Name | 5-[3-(2,5-dioxopyrrolidin-1-yl)phenyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169333937 |
| Molecular Formula | C15H11NO4 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 5-[3-(2,5-dioxopyrrolidin-1-yl)phenyl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2cccc(N3C(=O)CCC3=O)c2)o1 |
| InChI | InChI=1S/C15H11NO4/c17-9-12-4-5-13(20-12)10-2-1-3-11(8-10)16-14(18)6-7-15(16)19/h1-5,8-9H,6-7H2 |
| InChIKey | UZWCMVZKHUMOJT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|