C14H11NO3 — CID 168526590
1-[3-(furan-2-yl)phenyl]pyrrolidine-2,5-dione (PubChem CID 168526590) has the molecular formula C14H11NO3 and a molecular weight of 241.25 g/mol. Its IUPAC name is 1-[3-(furan-2-yl)phenyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[3-(furan-2-yl)phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 168526590 |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 1-[3-(furan-2-yl)phenyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1c1cccc(-c2ccco2)c1 |
| InChI | InChI=1S/C14H11NO3/c16-13-6-7-14(17)15(13)11-4-1-3-10(9-11)12-5-2-8-18-12/h1-5,8-9H,6-7H2 |
| InChIKey | NZWAPROKSSSXPL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|