About 3-(furan-2-yl)benzoate
3-(furan-2-yl)benzoate (PubChem CID 7023055) has the molecular formula C11H7O3-
and a molecular weight of 187.17 g/mol. Its IUPAC name is 3-(furan-2-yl)benzoate.
Molecular Properties
| Compound Name | 3-(furan-2-yl)benzoate |
| PubChem CID | 7023055 |
| Molecular Formula | C11H7O3- |
| Molecular Weight | 187.17 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | 3-(furan-2-yl)benzoate |
| SMILES | O=C([O-])c1cccc(-c2ccco2)c1 |
| InChI | InChI=1S/C11H8O3/c12-11(13)9-4-1-3-8(7-9)10-5-2-6-14-10/h1-7H,(H,12,13)/p-1 |
| InChIKey | RQVVFGRDMHDHNI-UHFFFAOYSA-M |
| XLogP | 1.31 |
| TPSA | 53.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.17 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(furan-2-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(furan-2-yl)benzoate?
The IUPAC name of 3-(furan-2-yl)benzoate (CID 7023055) is 3-(furan-2-yl)benzoate.
What is the SMILES notation for 3-(furan-2-yl)benzoate?
The canonical SMILES for 3-(furan-2-yl)benzoate is O=C([O-])c1cccc(-c2ccco2)c1.
What is the InChIKey of 3-(furan-2-yl)benzoate?
The InChIKey is RQVVFGRDMHDHNI-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H8O3/c12-11(13)9-4-1-3-8(7-9)10-5-2-6-14-10/h1-7H,(H,12,13)/p-1.
What are the key properties of 3-(furan-2-yl)benzoate?
3-(furan-2-yl)benzoate has a molecular weight of 187.17 g/mol, XLogP of 1.31, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(furan-2-yl)benzoate is sourced from PubChem (CID 7023055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).