C15H12F2O2 — CID 169334742
5-[3-(3,3-difluorocyclobutyl)phenyl]furan-2-carbaldehyde (PubChem CID 169334742) has the molecular formula C15H12F2O2 and a molecular weight of 262.25 g/mol. Its IUPAC name is 5-[3-(3,3-difluorocyclobutyl)phenyl]furan-2-carbaldehyde.
| Compound Name | 5-[3-(3,3-difluorocyclobutyl)phenyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169334742 |
| Molecular Formula | C15H12F2O2 |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 5-[3-(3,3-difluorocyclobutyl)phenyl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2cccc(C3CC(F)(F)C3)c2)o1 |
| InChI | InChI=1S/C15H12F2O2/c16-15(17)7-12(8-15)10-2-1-3-11(6-10)14-5-4-13(9-18)19-14/h1-6,9,12H,7-8H2 |
| InChIKey | QWGZQTNDPUAIJK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|