C21H13N5O2 — CID 169335117
5-[3-(3-pyridin-4-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]furan-2-carbaldehyde (PubChem CID 169335117) has the molecular formula C21H13N5O2 and a molecular weight of 367.37 g/mol. Its IUPAC name is 5-[3-(3-pyridin-4-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]furan-2-carbaldehyde.
| Compound Name | 5-[3-(3-pyridin-4-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 169335117 |
| Molecular Formula | C21H13N5O2 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 5-[3-(3-pyridin-4-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2cccc(-c3ccc4nnc(-c5ccncc5)n4n3)c2)o1 |
| InChI | InChI=1S/C21H13N5O2/c27-13-17-4-6-19(28-17)16-3-1-2-15(12-16)18-5-7-20-23-24-21(26(20)25-18)14-8-10-22-11-9-14/h1-13H |
| InChIKey | OMAUROCPRLJVLE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 86.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|