C24H14N6O2 — CID 168518993
2-[3-(3-pyridin-4-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]isoindole-1,3-dione (PubChem CID 168518993) has the molecular formula C24H14N6O2 and a molecular weight of 418.42 g/mol. Its IUPAC name is 2-[3-(3-pyridin-4-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]isoindole-1,3-dione.
| Compound Name | 2-[3-(3-pyridin-4-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168518993 |
| Molecular Formula | C24H14N6O2 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 2-[3-(3-pyridin-4-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1cccc(-c2ccc3nnc(-c4ccncc4)n3n2)c1 |
| InChI | InChI=1S/C24H14N6O2/c31-23-18-6-1-2-7-19(18)24(32)29(23)17-5-3-4-16(14-17)20-8-9-21-26-27-22(30(21)28-20)15-10-12-25-13-11-15/h1-14H |
| InChIKey | NZFSJXDWHXPHEB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 93.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|