C19H14N2O2 — CID 99726261
(Z)-3-[4-[6-[(Z)-3-oxoprop-1-enyl]imidazo[1,2-a]pyridin-2-yl]phenyl]prop-2-enal (PubChem CID 99726261) has the molecular formula C19H14N2O2 and a molecular weight of 302.33 g/mol. Its IUPAC name is (Z)-3-[4-[6-[(Z)-3-oxoprop-1-enyl]imidazo[1,2-a]pyridin-2-yl]phenyl]prop-2-enal.
| Compound Name | (Z)-3-[4-[6-[(Z)-3-oxoprop-1-enyl]imidazo[1,2-a]pyridin-2-yl]phenyl]prop-2-enal |
|---|---|
| PubChem CID | 99726261 |
| Molecular Formula | C19H14N2O2 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | (Z)-3-[4-[6-[(Z)-3-oxoprop-1-enyl]imidazo[1,2-a]pyridin-2-yl]phenyl]prop-2-enal |
| SMILES | O=C/C=C\c1ccc(-c2cn3cc(/C=C\C=O)ccc3n2)cc1 |
| InChI | InChI=1S/C19H14N2O2/c22-11-1-3-15-5-8-17(9-6-15)18-14-21-13-16(4-2-12-23)7-10-19(21)20-18/h1-14H/b3-1-,4-2- |
| InChIKey | ULOGAXDYVSGORE-CCAGOZQPSA-N |
| XLogP | 3.43 |
| TPSA | 51.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|