C15H10F3N3O — CID 146521508
[2-[4-(trifluoromethoxy)phenyl]imidazo[1,2-a]pyridin-6-yl]methanimine (PubChem CID 146521508) has the molecular formula C15H10F3N3O and a molecular weight of 305.26 g/mol. Its IUPAC name is [2-[4-(trifluoromethoxy)phenyl]imidazo[1,2-a]pyridin-6-yl]methanimine.
| Compound Name | [2-[4-(trifluoromethoxy)phenyl]imidazo[1,2-a]pyridin-6-yl]methanimine |
|---|---|
| PubChem CID | 146521508 |
| Molecular Formula | C15H10F3N3O |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | [2-[4-(trifluoromethoxy)phenyl]imidazo[1,2-a]pyridin-6-yl]methanimine |
| SMILES | [H]/N=C/c1ccc2nc(-c3ccc(OC(F)(F)F)cc3)cn2c1 |
| InChI | InChI=1S/C15H10F3N3O/c16-15(17,18)22-12-4-2-11(3-5-12)13-9-21-8-10(7-19)1-6-14(21)20-13/h1-9,19H/b19-7+ |
| InChIKey | CEJHXCZNSYNXSF-FBCYGCLPSA-N |
| XLogP | 3.90 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|