C16H16N2O2S — CID 5471256
[4-(phenylcarbamothioyl)phenyl] N,N-dimethylcarbamate (PubChem CID 5471256) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is [4-(phenylcarbamothioyl)phenyl] N,N-dimethylcarbamate.
| Compound Name | [4-(phenylcarbamothioyl)phenyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 5471256 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | [4-(phenylcarbamothioyl)phenyl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1ccc(C(=S)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C16H16N2O2S/c1-18(2)16(19)20-14-10-8-12(9-11-14)15(21)17-13-6-4-3-5-7-13/h3-11H,1-2H3,(H,17,21) |
| InChIKey | WBQVKZOMQRHJAF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|