C23H22N2O2S — CID 1096975
O-[4-(phenylcarbamoyl)phenyl] N-(3,4-dimethylphenyl)-N-methylcarbamothioate (PubChem CID 1096975) has the molecular formula C23H22N2O2S and a molecular weight of 390.51 g/mol. Its IUPAC name is O-[4-(phenylcarbamoyl)phenyl] N-(3,4-dimethylphenyl)-N-methylcarbamothioate.
| Compound Name | O-[4-(phenylcarbamoyl)phenyl] N-(3,4-dimethylphenyl)-N-methylcarbamothioate |
|---|---|
| PubChem CID | 1096975 |
| Molecular Formula | C23H22N2O2S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | O-[4-(phenylcarbamoyl)phenyl] N-(3,4-dimethylphenyl)-N-methylcarbamothioate |
| SMILES | Cc1ccc(N(C)C(=S)Oc2ccc(C(=O)Nc3ccccc3)cc2)cc1C |
| InChI | InChI=1S/C23H22N2O2S/c1-16-9-12-20(15-17(16)2)25(3)23(28)27-21-13-10-18(11-14-21)22(26)24-19-7-5-4-6-8-19/h4-15H,1-3H3,(H,24,26) |
| InChIKey | SPOYNJCDGXLNCK-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|