C12H11IN2O2 — CID 134861107
(3-iodoquinolin-5-yl) N,N-dimethylcarbamate (PubChem CID 134861107) has the molecular formula C12H11IN2O2 and a molecular weight of 342.14 g/mol. Its IUPAC name is (3-iodoquinolin-5-yl) N,N-dimethylcarbamate.
| Compound Name | (3-iodoquinolin-5-yl) N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 134861107 |
| Molecular Formula | C12H11IN2O2 |
| Molecular Weight | 342.14 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | (3-iodoquinolin-5-yl) N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1cccc2ncc(I)cc12 |
| InChI | InChI=1S/C12H11IN2O2/c1-15(2)12(16)17-11-5-3-4-10-9(11)6-8(13)7-14-10/h3-7H,1-2H3 |
| InChIKey | NOSSVJVOBIVYGB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.14 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|