C15H13FINO2 — CID 122373631
[2-(4-fluorophenyl)-6-iodophenyl] N,N-dimethylcarbamate (PubChem CID 122373631) has the molecular formula C15H13FINO2 and a molecular weight of 385.18 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-6-iodophenyl] N,N-dimethylcarbamate.
| Compound Name | [2-(4-fluorophenyl)-6-iodophenyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 122373631 |
| Molecular Formula | C15H13FINO2 |
| Molecular Weight | 385.18 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | [2-(4-fluorophenyl)-6-iodophenyl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1c(I)cccc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C15H13FINO2/c1-18(2)15(19)20-14-12(4-3-5-13(14)17)10-6-8-11(16)9-7-10/h3-9H,1-2H3 |
| InChIKey | JHMUUPOJDQGPBX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.18 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|