C34H46N4O12S2 — CID 173406299
[1-[10-[5-(dimethylcarbamoyloxy)isoquinolin-1-yl]decyl]isoquinolin-5-yl] N,N-dimethylcarbamate;sulfuric acid (PubChem CID 173406299) has the molecular formula C34H46N4O12S2 and a molecular weight of 766.89 g/mol. Its IUPAC name is [1-[10-[5-(dimethylcarbamoyloxy)isoquinolin-1-yl]decyl]isoquinolin-5-yl] N,N-dimethylcarbamate;sulfuric acid.
| Compound Name | [1-[10-[5-(dimethylcarbamoyloxy)isoquinolin-1-yl]decyl]isoquinolin-5-yl] N,N-dimethylcarbamate;sulfuric acid |
|---|---|
| PubChem CID | 173406299 |
| Molecular Formula | C34H46N4O12S2 |
| Molecular Weight | 766.89 g/mol |
| Exact Mass | 766.26 |
| IUPAC Name | [1-[10-[5-(dimethylcarbamoyloxy)isoquinolin-1-yl]decyl]isoquinolin-5-yl] N,N-dimethylcarbamate;sulfuric acid |
| SMILES | CN(C)C(=O)Oc1cccc2c(CCCCCCCCCCc3nccc4c(OC(=O)N(C)C)cccc34)nccc12.O=S(=O)(O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C34H42N4O4.2H2O4S/c1-37(2)33(39)41-31-19-13-15-25-27(31)21-23-35-29(25)17-11-9-7-5-6-8-10-12-18-30-26-16-14-20-32(28(26)22-24-36-30)42-34(40)38(3)4;2*1-5(2,3)4/h13-16,19-24H,5-12,17-18H2,1-4H3;2*(H2,1,2,3,4) |
| InChIKey | HZLAYTKMOFZMDA-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 234.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.89 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|