C24H46N4O2+2 — CID 165360156
[3-(dimethylcarbamoyloxy)-2-pyridinyl]methyl-dimethyl-[10-(trimethylazaniumyl)decyl]azanium (PubChem CID 165360156) has the molecular formula C24H46N4O2+2 and a molecular weight of 422.66 g/mol. Its IUPAC name is [3-(dimethylcarbamoyloxy)-2-pyridinyl]methyl-dimethyl-[10-(trimethylazaniumyl)decyl]azanium.
| Compound Name | [3-(dimethylcarbamoyloxy)-2-pyridinyl]methyl-dimethyl-[10-(trimethylazaniumyl)decyl]azanium |
|---|---|
| PubChem CID | 165360156 |
| Molecular Formula | C24H46N4O2+2 |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 422.36 |
| IUPAC Name | [3-(dimethylcarbamoyloxy)-2-pyridinyl]methyl-dimethyl-[10-(trimethylazaniumyl)decyl]azanium |
| SMILES | CN(C)C(=O)Oc1cccnc1C[N+](C)(C)CCCCCCCCCC[N+](C)(C)C |
| InChI | InChI=1S/C24H46N4O2/c1-26(2)24(29)30-23-17-16-18-25-22(23)21-28(6,7)20-15-13-11-9-8-10-12-14-19-27(3,4)5/h16-18H,8-15,19-21H2,1-7H3/q+2 |
| InChIKey | NHZIDWPQUOZVNG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|