C20H34ClN3O4 — CID 17065341
[3-(dimethylcarbamoyloxy)-2-pyridinyl]methyl-dimethyl-(2-propylpentanoyloxymethyl)azanium chloride (PubChem CID 17065341) has the molecular formula C20H34ClN3O4 and a molecular weight of 415.96 g/mol. Its IUPAC name is [3-(dimethylcarbamoyloxy)-2-pyridinyl]methyl-dimethyl-(2-propylpentanoyloxymethyl)azanium chloride.
| Compound Name | [3-(dimethylcarbamoyloxy)-2-pyridinyl]methyl-dimethyl-(2-propylpentanoyloxymethyl)azanium chloride |
|---|---|
| PubChem CID | 17065341 |
| Molecular Formula | C20H34ClN3O4 |
| Molecular Weight | 415.96 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | [3-(dimethylcarbamoyloxy)-2-pyridinyl]methyl-dimethyl-(2-propylpentanoyloxymethyl)azanium chloride |
| SMILES | CCCC(CCC)C(=O)OC[N+](C)(C)Cc1ncccc1OC(=O)N(C)C.[Cl-] |
| InChI | InChI=1S/C20H34N3O4.ClH/c1-7-10-16(11-8-2)19(24)26-15-23(5,6)14-17-18(12-9-13-21-17)27-20(25)22(3)4;/h9,12-13,16H,7-8,10-11,14-15H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | HUOYTKMUXVYFTP-UHFFFAOYSA-M |
| XLogP | 0.44 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.96 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|