C14H22N4O2 — CID 67568014
[2-[[butyl(methyl)amino]methylideneamino]-3-pyridinyl] N,N-dimethylcarbamate (PubChem CID 67568014) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is [2-[[butyl(methyl)amino]methylideneamino]-3-pyridinyl] N,N-dimethylcarbamate.
| Compound Name | [2-[[butyl(methyl)amino]methylideneamino]-3-pyridinyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 67568014 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | [2-[[butyl(methyl)amino]methylideneamino]-3-pyridinyl] N,N-dimethylcarbamate |
| SMILES | CCCCN(C)C=Nc1ncccc1OC(=O)N(C)C |
| InChI | InChI=1S/C14H22N4O2/c1-5-6-10-18(4)11-16-13-12(8-7-9-15-13)20-14(19)17(2)3/h7-9,11H,5-6,10H2,1-4H3 |
| InChIKey | UNMPIRZAMNGNFP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 58.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|