C19H33N3O2 — CID 70432937
[2-[[methyl(nonan-2-yl)amino]methyl]-3-pyridinyl] N,N-dimethylcarbamate (PubChem CID 70432937) has the molecular formula C19H33N3O2 and a molecular weight of 335.49 g/mol. Its IUPAC name is [2-[[methyl(nonan-2-yl)amino]methyl]-3-pyridinyl] N,N-dimethylcarbamate.
| Compound Name | [2-[[methyl(nonan-2-yl)amino]methyl]-3-pyridinyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 70432937 |
| Molecular Formula | C19H33N3O2 |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.26 |
| IUPAC Name | [2-[[methyl(nonan-2-yl)amino]methyl]-3-pyridinyl] N,N-dimethylcarbamate |
| SMILES | CCCCCCCC(C)N(C)Cc1ncccc1OC(=O)N(C)C |
| InChI | InChI=1S/C19H33N3O2/c1-6-7-8-9-10-12-16(2)22(5)15-17-18(13-11-14-20-17)24-19(23)21(3)4/h11,13-14,16H,6-10,12,15H2,1-5H3 |
| InChIKey | HFSXYAUHVAVUAP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|