C36H60N8O10 — CID 88659983
[2-[[1,8-dinitrooxyoctan-2-yl(methyl)amino]methyl]-3-pyridinyl] N,N-dimethylcarbamate;[2-[[methyl(octan-2-yl)amino]methyl]-3-pyridinyl] N,N-dimethylcarbamate (PubChem CID 88659983) has the molecular formula C36H60N8O10 and a molecular weight of 764.92 g/mol. Its IUPAC name is [2-[[1,8-dinitrooxyoctan-2-yl(methyl)amino]methyl]-3-pyridinyl] N,N-dimethylcarbamate;[2-[[methyl(octan-2-yl)amino]methyl]-3-pyridinyl] N,N-dimethylcarbamate.
| Compound Name | [2-[[1,8-dinitrooxyoctan-2-yl(methyl)amino]methyl]-3-pyridinyl] N,N-dimethylcarbamate;[2-[[methyl(octan-2-yl)amino]methyl]-3-pyridinyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 88659983 |
| Molecular Formula | C36H60N8O10 |
| Molecular Weight | 764.92 g/mol |
| Exact Mass | 764.44 |
| IUPAC Name | [2-[[1,8-dinitrooxyoctan-2-yl(methyl)amino]methyl]-3-pyridinyl] N,N-dimethylcarbamate;[2-[[methyl(octan-2-yl)amino]methyl]-3-pyridinyl] N,N-dimethylcarbamate |
| SMILES | CCCCCCC(C)N(C)Cc1ncccc1OC(=O)N(C)C.CN(C)C(=O)Oc1cccnc1CN(C)C(CCCCCCO[N+](=O)[O-])CO[N+](=O)[O-] |
| InChI | InChI=1S/C18H29N5O8.C18H31N3O2/c1-20(2)18(24)31-17-10-8-11-19-16(17)13-21(3)15(14-30-23(27)28)9-6-4-5-7-12-29-22(25)26;1-6-7-8-9-11-15(2)21(5)14-16-17(12-10-13-19-16)23-18(22)20(3)4/h8,10-11,15H,4-7,9,12-14H2,1-3H3;10,12-13,15H,6-9,11,14H2,1-5H3 |
| InChIKey | LHCDLCWMCSAYIC-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 196.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.92 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|