C27H45N3O10 — CID 88779584
[2-(dimethylcarbamoyloxy)phenyl]methyl-dimethyl-[8-(trimethylazaniumyl)octyl]azanium;bis(2-hydroxy-2-oxoacetate) (PubChem CID 88779584) has the molecular formula C27H45N3O10 and a molecular weight of 571.67 g/mol. Its IUPAC name is [2-(dimethylcarbamoyloxy)phenyl]methyl-dimethyl-[8-(trimethylazaniumyl)octyl]azanium;bis(2-hydroxy-2-oxoacetate).
| Compound Name | [2-(dimethylcarbamoyloxy)phenyl]methyl-dimethyl-[8-(trimethylazaniumyl)octyl]azanium;bis(2-hydroxy-2-oxoacetate) |
|---|---|
| PubChem CID | 88779584 |
| Molecular Formula | C27H45N3O10 |
| Molecular Weight | 571.67 g/mol |
| Exact Mass | 571.31 |
| IUPAC Name | [2-(dimethylcarbamoyloxy)phenyl]methyl-dimethyl-[8-(trimethylazaniumyl)octyl]azanium;bis(2-hydroxy-2-oxoacetate) |
| SMILES | CN(C)C(=O)Oc1ccccc1C[N+](C)(C)CCCCCCCC[N+](C)(C)C.O=C([O-])C(=O)O.O=C([O-])C(=O)O |
| InChI | InChI=1S/C23H43N3O2.2C2H2O4/c1-24(2)23(27)28-22-17-13-12-16-21(22)20-26(6,7)19-15-11-9-8-10-14-18-25(3,4)5;2*3-1(4)2(5)6/h12-13,16-17H,8-11,14-15,18-20H2,1-7H3;2*(H,3,4)(H,5,6)/q+2;;/p-2 |
| InChIKey | SFYCYWDCXAFHBN-UHFFFAOYSA-L |
| XLogP | 0.01 |
| TPSA | 184.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.67 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|