C18H34N2O2+2 — CID 12034190
3-hydroxypropyl-[[2-[[3-hydroxypropyl(dimethyl)azaniumyl]methyl]phenyl]methyl]-dimethylazanium (PubChem CID 12034190) has the molecular formula C18H34N2O2+2 and a molecular weight of 310.48 g/mol. Its IUPAC name is 3-hydroxypropyl-[[2-[[3-hydroxypropyl(dimethyl)azaniumyl]methyl]phenyl]methyl]-dimethylazanium.
| Compound Name | 3-hydroxypropyl-[[2-[[3-hydroxypropyl(dimethyl)azaniumyl]methyl]phenyl]methyl]-dimethylazanium |
|---|---|
| PubChem CID | 12034190 |
| Molecular Formula | C18H34N2O2+2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.26 |
| IUPAC Name | 3-hydroxypropyl-[[2-[[3-hydroxypropyl(dimethyl)azaniumyl]methyl]phenyl]methyl]-dimethylazanium |
| SMILES | C[N+](C)(CCCO)Cc1ccccc1C[N+](C)(C)CCCO |
| InChI | InChI=1S/C18H34N2O2/c1-19(2,11-7-13-21)15-17-9-5-6-10-18(17)16-20(3,4)12-8-14-22/h5-6,9-10,21-22H,7-8,11-16H2,1-4H3/q+2 |
| InChIKey | FEFOUEPIERPROI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|