C20H36ClNO — CID 141352392
decyl-[[2-(hydroxymethyl)phenyl]methyl]-dimethylazanium chloride (PubChem CID 141352392) has the molecular formula C20H36ClNO and a molecular weight of 341.97 g/mol. Its IUPAC name is decyl-[[2-(hydroxymethyl)phenyl]methyl]-dimethylazanium chloride.
| Compound Name | decyl-[[2-(hydroxymethyl)phenyl]methyl]-dimethylazanium chloride |
|---|---|
| PubChem CID | 141352392 |
| Molecular Formula | C20H36ClNO |
| Molecular Weight | 341.97 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | decyl-[[2-(hydroxymethyl)phenyl]methyl]-dimethylazanium chloride |
| SMILES | CCCCCCCCCC[N+](C)(C)Cc1ccccc1CO.[Cl-] |
| InChI | InChI=1S/C20H36NO.ClH/c1-4-5-6-7-8-9-10-13-16-21(2,3)17-19-14-11-12-15-20(19)18-22;/h11-12,14-15,22H,4-10,13,16-18H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | RCGWNHGPQVGYAG-UHFFFAOYSA-M |
| XLogP | 1.90 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.97 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|