C17H31N3O2+2 — CID 135121841
[2-(dimethylcarbamoyloxy)-3-[(trimethylazaniumyl)methyl]phenyl]methyl-trimethylazanium (PubChem CID 135121841) has the molecular formula C17H31N3O2+2 and a molecular weight of 309.45 g/mol. Its IUPAC name is [2-(dimethylcarbamoyloxy)-3-[(trimethylazaniumyl)methyl]phenyl]methyl-trimethylazanium.
| Compound Name | [2-(dimethylcarbamoyloxy)-3-[(trimethylazaniumyl)methyl]phenyl]methyl-trimethylazanium |
|---|---|
| PubChem CID | 135121841 |
| Molecular Formula | C17H31N3O2+2 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.24 |
| IUPAC Name | [2-(dimethylcarbamoyloxy)-3-[(trimethylazaniumyl)methyl]phenyl]methyl-trimethylazanium |
| SMILES | CN(C)C(=O)Oc1c(C[N+](C)(C)C)cccc1C[N+](C)(C)C |
| InChI | InChI=1S/C17H31N3O2/c1-18(2)17(21)22-16-14(12-19(3,4)5)10-9-11-15(16)13-20(6,7)8/h9-11H,12-13H2,1-8H3/q+2 |
| InChIKey | JCEMUFRMNKDEHN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|