C15H24NO+ — CID 102198520
[2-(2,2-dimethylpropanoyl)phenyl]methyl-trimethylazanium (PubChem CID 102198520) has the molecular formula C15H24NO+ and a molecular weight of 234.36 g/mol. Its IUPAC name is [2-(2,2-dimethylpropanoyl)phenyl]methyl-trimethylazanium.
| Compound Name | [2-(2,2-dimethylpropanoyl)phenyl]methyl-trimethylazanium |
|---|---|
| PubChem CID | 102198520 |
| Molecular Formula | C15H24NO+ |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.19 |
| IUPAC Name | [2-(2,2-dimethylpropanoyl)phenyl]methyl-trimethylazanium |
| SMILES | CC(C)(C)C(=O)c1ccccc1C[N+](C)(C)C |
| InChI | InChI=1S/C15H24NO/c1-15(2,3)14(17)13-10-8-7-9-12(13)11-16(4,5)6/h7-10H,11H2,1-6H3/q+1 |
| InChIKey | RPCBUPGPHDMDJX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|