C18H18O3S2 — CID 58554631
2-[[2-(2,2-dimethylpropanoyl)phenyl]disulfanyl]benzoic acid (PubChem CID 58554631) has the molecular formula C18H18O3S2 and a molecular weight of 346.47 g/mol. Its IUPAC name is 2-[[2-(2,2-dimethylpropanoyl)phenyl]disulfanyl]benzoic acid.
| Compound Name | 2-[[2-(2,2-dimethylpropanoyl)phenyl]disulfanyl]benzoic acid |
|---|---|
| PubChem CID | 58554631 |
| Molecular Formula | C18H18O3S2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 2-[[2-(2,2-dimethylpropanoyl)phenyl]disulfanyl]benzoic acid |
| SMILES | CC(C)(C)C(=O)c1ccccc1SSc1ccccc1C(=O)O |
| InChI | InChI=1S/C18H18O3S2/c1-18(2,3)16(19)12-8-4-6-10-14(12)22-23-15-11-7-5-9-13(15)17(20)21/h4-11H,1-3H3,(H,20,21) |
| InChIKey | ZTVNEELBQNCHAB-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|