C22H30O4S4 — CID 160722778
2-[6-[(2-carboxyphenyl)disulfanyl]hexyldisulfanyl]benzoic acid;methane (PubChem CID 160722778) has the molecular formula C22H30O4S4 and a molecular weight of 486.75 g/mol. Its IUPAC name is 2-[6-[(2-carboxyphenyl)disulfanyl]hexyldisulfanyl]benzoic acid;methane.
| Compound Name | 2-[6-[(2-carboxyphenyl)disulfanyl]hexyldisulfanyl]benzoic acid;methane |
|---|---|
| PubChem CID | 160722778 |
| Molecular Formula | C22H30O4S4 |
| Molecular Weight | 486.75 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 2-[6-[(2-carboxyphenyl)disulfanyl]hexyldisulfanyl]benzoic acid;methane |
| SMILES | C.C.O=C(O)c1ccccc1SSCCCCCCSSc1ccccc1C(=O)O |
| InChI | InChI=1S/C20H22O4S4.2CH4/c21-19(22)15-9-3-5-11-17(15)27-25-13-7-1-2-8-14-26-28-18-12-6-4-10-16(18)20(23)24;;/h3-6,9-12H,1-2,7-8,13-14H2,(H,21,22)(H,23,24);2*1H4 |
| InChIKey | RTHYAEIBCQUBMK-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.75 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|