C10H12O2S3 — CID 12716629
2-[1,3-bis(sulfanyl)propan-2-ylsulfanyl]benzoic acid (PubChem CID 12716629) has the molecular formula C10H12O2S3 and a molecular weight of 260.40 g/mol. Its IUPAC name is 2-[1,3-bis(sulfanyl)propan-2-ylsulfanyl]benzoic acid.
| Compound Name | 2-[1,3-bis(sulfanyl)propan-2-ylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 12716629 |
| Molecular Formula | C10H12O2S3 |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | 2-[1,3-bis(sulfanyl)propan-2-ylsulfanyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1SC(CS)CS |
| InChI | InChI=1S/C10H12O2S3/c11-10(12)8-3-1-2-4-9(8)15-7(5-13)6-14/h1-4,7,13-14H,5-6H2,(H,11,12) |
| InChIKey | TUBHGWIUAQEJEK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|