About 2-[(2-carboxyphenyl)disulfanyl]benzoic acid;triphenylphosphane
2-[(2-carboxyphenyl)disulfanyl]benzoic acid;triphenylphosphane (PubChem CID 175488218) has the molecular formula C32H25O4PS2
and a molecular weight of 568.66 g/mol. Its IUPAC name is 2-[(2-carboxyphenyl)disulfanyl]benzoic acid;triphenylphosphane.
Molecular Properties
| Compound Name | 2-[(2-carboxyphenyl)disulfanyl]benzoic acid;triphenylphosphane |
| PubChem CID | 175488218 |
| Molecular Formula | C32H25O4PS2 |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.09 |
| IUPAC Name | 2-[(2-carboxyphenyl)disulfanyl]benzoic acid;triphenylphosphane |
| SMILES | O=C(O)c1ccccc1SSc1ccccc1C(=O)O.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C14H10O4S2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;15-13(16)9-5-1-3-7-11(9)19-20-12-8-4-2-6-10(12)14(17)18/h1-15H;1-8H,(H,15,16)(H,17,18) |
| InChIKey | QHUQIOYLEDPNFZ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-carboxyphenyl)disulfanyl]benzoic acid;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-carboxyphenyl)disulfanyl]benzoic acid;triphenylphosphane?
The IUPAC name of 2-[(2-carboxyphenyl)disulfanyl]benzoic acid;triphenylphosphane (CID 175488218) is 2-[(2-carboxyphenyl)disulfanyl]benzoic acid;triphenylphosphane.
What is the SMILES notation for 2-[(2-carboxyphenyl)disulfanyl]benzoic acid;triphenylphosphane?
The canonical SMILES for 2-[(2-carboxyphenyl)disulfanyl]benzoic acid;triphenylphosphane is O=C(O)c1ccccc1SSc1ccccc1C(=O)O.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 2-[(2-carboxyphenyl)disulfanyl]benzoic acid;triphenylphosphane?
The InChIKey is QHUQIOYLEDPNFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C14H10O4S2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;15-13(16)9-5-1-3-7-11(9)19-20-12-8-4-2-6-10(12)14(17)18/h1-15H;1-8H,(H,15,16)(H,17,18).
What are the key properties of 2-[(2-carboxyphenyl)disulfanyl]benzoic acid;triphenylphosphane?
2-[(2-carboxyphenyl)disulfanyl]benzoic acid;triphenylphosphane has a molecular weight of 568.66 g/mol, XLogP of 7.33, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-carboxyphenyl)disulfanyl]benzoic acid;triphenylphosphane is sourced from PubChem (CID 175488218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).