About sulfur dioxide;triphenylphosphane
sulfur dioxide;triphenylphosphane (PubChem CID 160748722) has the molecular formula C18H15O2PS
and a molecular weight of 326.36 g/mol. Its IUPAC name is sulfur dioxide;triphenylphosphane.
Molecular Properties
| Compound Name | sulfur dioxide;triphenylphosphane |
| PubChem CID | 160748722 |
| Molecular Formula | C18H15O2PS |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | sulfur dioxide;triphenylphosphane |
| SMILES | O=S=O.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.O2S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-2/h1-15H; |
| InChIKey | RWNKMHXNOUVQAG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sulfur dioxide;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfur dioxide;triphenylphosphane?
The IUPAC name of sulfur dioxide;triphenylphosphane (CID 160748722) is sulfur dioxide;triphenylphosphane.
What is the SMILES notation for sulfur dioxide;triphenylphosphane?
The canonical SMILES for sulfur dioxide;triphenylphosphane is O=S=O.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of sulfur dioxide;triphenylphosphane?
The InChIKey is RWNKMHXNOUVQAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.O2S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-2/h1-15H;.
What are the key properties of sulfur dioxide;triphenylphosphane?
sulfur dioxide;triphenylphosphane has a molecular weight of 326.36 g/mol, XLogP of 2.77, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sulfur dioxide;triphenylphosphane is sourced from PubChem (CID 160748722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).