sulfur dioxide;triphenylphosphane

C18H15O2PS — CID 160748722

IUPACsulfur dioxide;triphenylphosphane
SMILESO=S=O.c1ccc(P(c2ccccc2)c2ccccc2)cc1
InChIInChI=1S/C18H15P.O2S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-2/h1-15H;
InChIKeyRWNKMHXNOUVQAG-UHFFFAOYSA-N
MW326.36 g/mol
LogP2.77
Rot. Bonds3

About sulfur dioxide;triphenylphosphane

sulfur dioxide;triphenylphosphane (PubChem CID 160748722) has the molecular formula C18H15O2PS and a molecular weight of 326.36 g/mol. Its IUPAC name is sulfur dioxide;triphenylphosphane.

Molecular Properties

Compound Namesulfur dioxide;triphenylphosphane
PubChem CID160748722
Molecular FormulaC18H15O2PS
Molecular Weight326.36 g/mol
Exact Mass326.05
IUPAC Namesulfur dioxide;triphenylphosphane
SMILESO=S=O.c1ccc(P(c2ccccc2)c2ccccc2)cc1
InChIInChI=1S/C18H15P.O2S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-2/h1-15H;
InChIKeyRWNKMHXNOUVQAG-UHFFFAOYSA-N
XLogP2.77
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500326.36
LogP ≤ 52.77
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze sulfur dioxide;triphenylphosphane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sulfur dioxide;triphenylphosphane?
The IUPAC name of sulfur dioxide;triphenylphosphane (CID 160748722) is sulfur dioxide;triphenylphosphane.
What is the SMILES notation for sulfur dioxide;triphenylphosphane?
The canonical SMILES for sulfur dioxide;triphenylphosphane is O=S=O.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of sulfur dioxide;triphenylphosphane?
The InChIKey is RWNKMHXNOUVQAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.O2S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-2/h1-15H;.
What are the key properties of sulfur dioxide;triphenylphosphane?
sulfur dioxide;triphenylphosphane has a molecular weight of 326.36 g/mol, XLogP of 2.77, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sulfur dioxide;triphenylphosphane is sourced from PubChem (CID 160748722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).