C53H46O4P2S2+2 — CID 175915427
2-[(2-carboxyphenyl)disulfanyl]benzoic acid;triphenyl(3-triphenylphosphaniumylpropyl)phosphanium (PubChem CID 175915427) has the molecular formula C53H46O4P2S2+2 and a molecular weight of 873.03 g/mol. Its IUPAC name is 2-[(2-carboxyphenyl)disulfanyl]benzoic acid;triphenyl(3-triphenylphosphaniumylpropyl)phosphanium.
| Compound Name | 2-[(2-carboxyphenyl)disulfanyl]benzoic acid;triphenyl(3-triphenylphosphaniumylpropyl)phosphanium |
|---|---|
| PubChem CID | 175915427 |
| Molecular Formula | C53H46O4P2S2+2 |
| Molecular Weight | 873.03 g/mol |
| Exact Mass | 872.23 |
| IUPAC Name | 2-[(2-carboxyphenyl)disulfanyl]benzoic acid;triphenyl(3-triphenylphosphaniumylpropyl)phosphanium |
| SMILES | O=C(O)c1ccccc1SSc1ccccc1C(=O)O.c1ccc([P+](CCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C39H36P2.C14H10O4S2/c1-7-20-34(21-8-1)40(35-22-9-2-10-23-35,36-24-11-3-12-25-36)32-19-33-41(37-26-13-4-14-27-37,38-28-15-5-16-29-38)39-30-17-6-18-31-39;15-13(16)9-5-1-3-7-11(9)19-20-12-8-4-2-6-10(12)14(17)18/h1-18,20-31H,19,32-33H2;1-8H,(H,15,16)(H,17,18)/q+2; |
| InChIKey | QWMSMFTUZAGBCA-UHFFFAOYSA-N |
| XLogP | 11.25 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.03 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|