C15H16O6 — CID 89488713
2-acetyl-5-(2,2-dimethylpropanoyl)terephthalic acid (PubChem CID 89488713) has the molecular formula C15H16O6 and a molecular weight of 292.29 g/mol. Its IUPAC name is 2-acetyl-5-(2,2-dimethylpropanoyl)terephthalic acid.
| Compound Name | 2-acetyl-5-(2,2-dimethylpropanoyl)terephthalic acid |
|---|---|
| PubChem CID | 89488713 |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2-acetyl-5-(2,2-dimethylpropanoyl)terephthalic acid |
| SMILES | CC(=O)c1cc(C(=O)O)c(C(=O)C(C)(C)C)cc1C(=O)O |
| InChI | InChI=1S/C15H16O6/c1-7(16)8-5-11(14(20)21)9(6-10(8)13(18)19)12(17)15(2,3)4/h5-6H,1-4H3,(H,18,19)(H,20,21) |
| InChIKey | QBHZAVFNWBQAFN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |