2-acetyl-5-(2,2-dimethylpropanoyl)terephthalic acid

C15H16O6 — CID 89488713

IUPAC2-acetyl-5-(2,2-dimethylpropanoyl)terephthalic acid
SMILESCC(=O)c1cc(C(=O)O)c(C(=O)C(C)(C)C)cc1C(=O)O
InChIInChI=1S/C15H16O6/c1-7(16)8-5-11(14(20)21)9(6-10(8)13(18)19)12(17)15(2,3)4/h5-6H,1-4H3,(H,18,19)(H,20,21)
InChIKeyQBHZAVFNWBQAFN-UHFFFAOYSA-N
MW292.29 g/mol
LogP2.51
Rot. Bonds4

About 2-acetyl-5-(2,2-dimethylpropanoyl)terephthalic acid

2-acetyl-5-(2,2-dimethylpropanoyl)terephthalic acid (PubChem CID 89488713) has the molecular formula C15H16O6 and a molecular weight of 292.29 g/mol. Its IUPAC name is 2-acetyl-5-(2,2-dimethylpropanoyl)terephthalic acid.

Molecular Properties

Compound Name2-acetyl-5-(2,2-dimethylpropanoyl)terephthalic acid
PubChem CID89488713
Molecular FormulaC15H16O6
Molecular Weight292.29 g/mol
Exact Mass292.09
IUPAC Name2-acetyl-5-(2,2-dimethylpropanoyl)terephthalic acid
SMILESCC(=O)c1cc(C(=O)O)c(C(=O)C(C)(C)C)cc1C(=O)O
InChIInChI=1S/C15H16O6/c1-7(16)8-5-11(14(20)21)9(6-10(8)13(18)19)12(17)15(2,3)4/h5-6H,1-4H3,(H,18,19)(H,20,21)
InChIKeyQBHZAVFNWBQAFN-UHFFFAOYSA-N
XLogP2.51
TPSA108.74 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500292.29
LogP ≤ 52.51
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-acetyl-5-(2,2-dimethylpropanoyl)terephthalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-acetyl-5-(2,2-dimethylpropanoyl)terephthalic acid?
The IUPAC name of 2-acetyl-5-(2,2-dimethylpropanoyl)terephthalic acid (CID 89488713) is 2-acetyl-5-(2,2-dimethylpropanoyl)terephthalic acid.
What is the SMILES notation for 2-acetyl-5-(2,2-dimethylpropanoyl)terephthalic acid?
The canonical SMILES for 2-acetyl-5-(2,2-dimethylpropanoyl)terephthalic acid is CC(=O)c1cc(C(=O)O)c(C(=O)C(C)(C)C)cc1C(=O)O.
What is the InChIKey of 2-acetyl-5-(2,2-dimethylpropanoyl)terephthalic acid?
The InChIKey is QBHZAVFNWBQAFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O6/c1-7(16)8-5-11(14(20)21)9(6-10(8)13(18)19)12(17)15(2,3)4/h5-6H,1-4H3,(H,18,19)(H,20,21).
What are the key properties of 2-acetyl-5-(2,2-dimethylpropanoyl)terephthalic acid?
2-acetyl-5-(2,2-dimethylpropanoyl)terephthalic acid has a molecular weight of 292.29 g/mol, XLogP of 2.51, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyl-5-(2,2-dimethylpropanoyl)terephthalic acid is sourced from PubChem (CID 89488713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).