C15H20N2O4 — CID 24836202
[2-(dimethylcarbamoyloxy)-3-prop-2-enylphenyl] N,N-dimethylcarbamate (PubChem CID 24836202) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is [2-(dimethylcarbamoyloxy)-3-prop-2-enylphenyl] N,N-dimethylcarbamate.
| Compound Name | [2-(dimethylcarbamoyloxy)-3-prop-2-enylphenyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 24836202 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | [2-(dimethylcarbamoyloxy)-3-prop-2-enylphenyl] N,N-dimethylcarbamate |
| SMILES | C=CCc1cccc(OC(=O)N(C)C)c1OC(=O)N(C)C |
| InChI | InChI=1S/C15H20N2O4/c1-6-8-11-9-7-10-12(20-14(18)16(2)3)13(11)21-15(19)17(4)5/h6-7,9-10H,1,8H2,2-5H3 |
| InChIKey | VDRUCRBMBMTCDO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|