C12H16O4 — CID 174703857
acetic acid;2-methoxy-3-prop-2-enylphenol (PubChem CID 174703857) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is acetic acid;2-methoxy-3-prop-2-enylphenol.
| Compound Name | acetic acid;2-methoxy-3-prop-2-enylphenol |
|---|---|
| PubChem CID | 174703857 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | acetic acid;2-methoxy-3-prop-2-enylphenol |
| SMILES | C=CCc1cccc(O)c1OC.CC(=O)O |
| InChI | InChI=1S/C10H12O2.C2H4O2/c1-3-5-8-6-4-7-9(11)10(8)12-2;1-2(3)4/h3-4,6-7,11H,1,5H2,2H3;1H3,(H,3,4) |
| InChIKey | JQXZUHAFPOXPRB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|