C14H21ClN2O6S — CID 69220786
[3-[(2S,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]oxypyridin-1-ium-1-yl]methyl N,N-dimethylcarbamate chloride (PubChem CID 69220786) has the molecular formula C14H21ClN2O6S and a molecular weight of 380.85 g/mol. Its IUPAC name is [3-[(2S,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]oxypyridin-1-ium-1-yl]methyl N,N-dimethylcarbamate chloride.
| Compound Name | [3-[(2S,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]oxypyridin-1-ium-1-yl]methyl N,N-dimethylcarbamate chloride |
|---|---|
| PubChem CID | 69220786 |
| Molecular Formula | C14H21ClN2O6S |
| Molecular Weight | 380.85 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | [3-[(2S,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]oxypyridin-1-ium-1-yl]methyl N,N-dimethylcarbamate chloride |
| SMILES | CN(C)C(=O)OC[n+]1cccc(O[C@H]2SC[C@@H](O)[C@H](O)[C@H]2O)c1.[Cl-] |
| InChI | InChI=1S/C14H21N2O6S.ClH/c1-15(2)14(20)21-8-16-5-3-4-9(6-16)22-13-12(19)11(18)10(17)7-23-13;/h3-6,10-13,17-19H,7-8H2,1-2H3;1H/q+1;/p-1/t10-,11+,12-,13+;/m1./s1 |
| InChIKey | ZYOZNXRWNCIJFO-ZNPJUTMZSA-M |
| XLogP | -3.83 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.85 |
| LogP ≤ 5 | -3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|