About 1-benzylpyridin-1-ium-3-sulfonate;hydron
1-benzylpyridin-1-ium-3-sulfonate;hydron (PubChem CID 101092227) has the molecular formula C12H12NO3S+
and a molecular weight of 250.30 g/mol. Its IUPAC name is 1-benzylpyridin-1-ium-3-sulfonate;hydron.
Molecular Properties
| Compound Name | 1-benzylpyridin-1-ium-3-sulfonate;hydron |
| PubChem CID | 101092227 |
| Molecular Formula | C12H12NO3S+ |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 1-benzylpyridin-1-ium-3-sulfonate;hydron |
| SMILES | O=S(=O)([O-])c1ccc[n+](Cc2ccccc2)c1.[H+] |
| InChI | InChI=1S/C12H11NO3S/c14-17(15,16)12-7-4-8-13(10-12)9-11-5-2-1-3-6-11/h1-8,10H,9H2/p+1 |
| InChIKey | BUHVHBJRTMUDGJ-UHFFFAOYSA-O |
| XLogP | 1.04 |
| TPSA | 61.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-benzylpyridin-1-ium-3-sulfonate;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylpyridin-1-ium-3-sulfonate;hydron?
The IUPAC name of 1-benzylpyridin-1-ium-3-sulfonate;hydron (CID 101092227) is 1-benzylpyridin-1-ium-3-sulfonate;hydron.
What is the SMILES notation for 1-benzylpyridin-1-ium-3-sulfonate;hydron?
The canonical SMILES for 1-benzylpyridin-1-ium-3-sulfonate;hydron is O=S(=O)([O-])c1ccc[n+](Cc2ccccc2)c1.[H+].
What is the InChIKey of 1-benzylpyridin-1-ium-3-sulfonate;hydron?
The InChIKey is BUHVHBJRTMUDGJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H11NO3S/c14-17(15,16)12-7-4-8-13(10-12)9-11-5-2-1-3-6-11/h1-8,10H,9H2/p+1.
What are the key properties of 1-benzylpyridin-1-ium-3-sulfonate;hydron?
1-benzylpyridin-1-ium-3-sulfonate;hydron has a molecular weight of 250.30 g/mol, XLogP of 1.04, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylpyridin-1-ium-3-sulfonate;hydron is sourced from PubChem (CID 101092227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).