C16H16F3N2O3+ — CID 53382129
1-[2-[3-(trifluoromethyl)phenoxy]ethoxymethyl]pyridin-1-ium-3-carboxamide (PubChem CID 53382129) has the molecular formula C16H16F3N2O3+ and a molecular weight of 341.31 g/mol. Its IUPAC name is 1-[2-[3-(trifluoromethyl)phenoxy]ethoxymethyl]pyridin-1-ium-3-carboxamide.
| Compound Name | 1-[2-[3-(trifluoromethyl)phenoxy]ethoxymethyl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 53382129 |
| Molecular Formula | C16H16F3N2O3+ |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 1-[2-[3-(trifluoromethyl)phenoxy]ethoxymethyl]pyridin-1-ium-3-carboxamide |
| SMILES | NC(=O)c1ccc[n+](COCCOc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H15F3N2O3/c17-16(18,19)13-4-1-5-14(9-13)24-8-7-23-11-21-6-2-3-12(10-21)15(20)22/h1-6,9-10H,7-8,11H2,(H-,20,22)/p+1 |
| InChIKey | MEQRXWPPNFXKEN-UHFFFAOYSA-O |
| XLogP | 2.14 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|