C13H17F2NO4 — CID 155796910
2,2-difluoro-2-[3-[2-(2-methoxyethoxy)ethoxy]phenyl]acetamide (PubChem CID 155796910) has the molecular formula C13H17F2NO4 and a molecular weight of 289.28 g/mol. Its IUPAC name is 2,2-difluoro-2-[3-[2-(2-methoxyethoxy)ethoxy]phenyl]acetamide.
| Compound Name | 2,2-difluoro-2-[3-[2-(2-methoxyethoxy)ethoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 155796910 |
| Molecular Formula | C13H17F2NO4 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 2,2-difluoro-2-[3-[2-(2-methoxyethoxy)ethoxy]phenyl]acetamide |
| SMILES | COCCOCCOc1cccc(C(F)(F)C(N)=O)c1 |
| InChI | InChI=1S/C13H17F2NO4/c1-18-5-6-19-7-8-20-11-4-2-3-10(9-11)13(14,15)12(16)17/h2-4,9H,5-8H2,1H3,(H2,16,17) |
| InChIKey | CNFYRMVESFORHE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|