C15H17N2O3+ — CID 7529007
1-[2-(4-methoxyphenoxy)ethyl]pyridin-1-ium-3-carboxamide (PubChem CID 7529007) has the molecular formula C15H17N2O3+ and a molecular weight of 273.31 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenoxy)ethyl]pyridin-1-ium-3-carboxamide.
| Compound Name | 1-[2-(4-methoxyphenoxy)ethyl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 7529007 |
| Molecular Formula | C15H17N2O3+ |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 1-[2-(4-methoxyphenoxy)ethyl]pyridin-1-ium-3-carboxamide |
| SMILES | COc1ccc(OCC[n+]2cccc(C(N)=O)c2)cc1 |
| InChI | InChI=1S/C15H16N2O3/c1-19-13-4-6-14(7-5-13)20-10-9-17-8-2-3-12(11-17)15(16)18/h2-8,11H,9-10H2,1H3,(H-,16,18)/p+1 |
| InChIKey | LFKGUXQRUWOTGW-UHFFFAOYSA-O |
| XLogP | 1.16 |
| TPSA | 65.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|