C16H25IN2O3 — CID 23126884
2-(3-carbamoylpyridin-1-ium-1-yl)ethyl 2-propan-2-ylpentanoate iodide (PubChem CID 23126884) has the molecular formula C16H25IN2O3 and a molecular weight of 420.29 g/mol. Its IUPAC name is 2-(3-carbamoylpyridin-1-ium-1-yl)ethyl 2-propan-2-ylpentanoate iodide.
| Compound Name | 2-(3-carbamoylpyridin-1-ium-1-yl)ethyl 2-propan-2-ylpentanoate iodide |
|---|---|
| PubChem CID | 23126884 |
| Molecular Formula | C16H25IN2O3 |
| Molecular Weight | 420.29 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 2-(3-carbamoylpyridin-1-ium-1-yl)ethyl 2-propan-2-ylpentanoate iodide |
| SMILES | CCCC(C(=O)OCC[n+]1cccc(C(N)=O)c1)C(C)C.[I-] |
| InChI | InChI=1S/C16H24N2O3.HI/c1-4-6-14(12(2)3)16(20)21-10-9-18-8-5-7-13(11-18)15(17)19;/h5,7-8,11-12,14H,4,6,9-10H2,1-3H3,(H-,17,19);1H |
| InChIKey | XFWBHZYSNXOWIG-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 73.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.29 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|