C14H19N4O2+ — CID 123289092
1-[2-[[(E)-2-carbamoylpent-2-enylidene]amino]ethyl]pyridin-1-ium-3-carboxamide (PubChem CID 123289092) has the molecular formula C14H19N4O2+ and a molecular weight of 275.33 g/mol. Its IUPAC name is 1-[2-[[(E)-2-carbamoylpent-2-enylidene]amino]ethyl]pyridin-1-ium-3-carboxamide.
| Compound Name | 1-[2-[[(E)-2-carbamoylpent-2-enylidene]amino]ethyl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 123289092 |
| Molecular Formula | C14H19N4O2+ |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 1-[2-[[(E)-2-carbamoylpent-2-enylidene]amino]ethyl]pyridin-1-ium-3-carboxamide |
| SMILES | CC/C=C(\C=N\CC[n+]1cccc(C(N)=O)c1)C(N)=O |
| InChI | InChI=1S/C14H18N4O2/c1-2-4-11(13(15)19)9-17-6-8-18-7-3-5-12(10-18)14(16)20/h3-5,7,9-10H,2,6,8H2,1H3,(H3-,15,16,19,20)/p+1/b11-4+,17-9+ |
| InChIKey | DWNJVVRJNIRTMC-BKSWVSJHSA-O |
| XLogP | -0.03 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|