C15H17N5O3+2 — CID 176731737
1-[2-[3-[(2-hydroxyiminoacetyl)amino]pyridin-1-ium-1-yl]ethyl]pyridin-1-ium-4-carboxamide (PubChem CID 176731737) has the molecular formula C15H17N5O3+2 and a molecular weight of 315.33 g/mol. Its IUPAC name is 1-[2-[3-[(2-hydroxyiminoacetyl)amino]pyridin-1-ium-1-yl]ethyl]pyridin-1-ium-4-carboxamide.
| Compound Name | 1-[2-[3-[(2-hydroxyiminoacetyl)amino]pyridin-1-ium-1-yl]ethyl]pyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 176731737 |
| Molecular Formula | C15H17N5O3+2 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 1-[2-[3-[(2-hydroxyiminoacetyl)amino]pyridin-1-ium-1-yl]ethyl]pyridin-1-ium-4-carboxamide |
| SMILES | NC(=O)c1cc[n+](CC[n+]2cccc(NC(=O)C=NO)c2)cc1 |
| InChI | InChI=1S/C15H15N5O3/c16-15(22)12-3-6-19(7-4-12)8-9-20-5-1-2-13(11-20)18-14(21)10-17-23/h1-7,10-11H,8-9H2,(H2-2,16,18,21,22,23)/p+2 |
| InChIKey | GZSKMCZMTCQYOP-UHFFFAOYSA-P |
| XLogP | -0.54 |
| TPSA | 112.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|