C21H28N6O4+2 — CID 90656256
(2Z)-2-hydroxyimino-N-[1-[7-[3-[[(2Z)-2-hydroxyiminoacetyl]amino]pyridin-1-ium-1-yl]heptyl]pyridin-1-ium-3-yl]acetamide (PubChem CID 90656256) has the molecular formula C21H28N6O4+2 and a molecular weight of 428.49 g/mol. Its IUPAC name is (2Z)-2-hydroxyimino-N-[1-[7-[3-[[(2Z)-2-hydroxyiminoacetyl]amino]pyridin-1-ium-1-yl]heptyl]pyridin-1-ium-3-yl]acetamide.
| Compound Name | (2Z)-2-hydroxyimino-N-[1-[7-[3-[[(2Z)-2-hydroxyiminoacetyl]amino]pyridin-1-ium-1-yl]heptyl]pyridin-1-ium-3-yl]acetamide |
|---|---|
| PubChem CID | 90656256 |
| Molecular Formula | C21H28N6O4+2 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | (2Z)-2-hydroxyimino-N-[1-[7-[3-[[(2Z)-2-hydroxyiminoacetyl]amino]pyridin-1-ium-1-yl]heptyl]pyridin-1-ium-3-yl]acetamide |
| SMILES | O=C(/C=N\O)Nc1ccc[n+](CCCCCCC[n+]2cccc(NC(=O)/C=N\O)c2)c1 |
| InChI | InChI=1S/C21H26N6O4/c28-20(14-22-30)24-18-8-6-12-26(16-18)10-4-2-1-3-5-11-27-13-7-9-19(17-27)25-21(29)15-23-31/h6-9,12-17H,1-5,10-11H2,(H2-2,24,25,28,29,30,31)/p+2 |
| InChIKey | BZDSVXCHLHSRCC-UHFFFAOYSA-P |
| XLogP | 1.71 |
| TPSA | 131.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|