C17H20N6O4+2 — CID 18527197
(2E)-2-hydroxyimino-N-[1-[3-[3-[[(2E)-2-hydroxyiminoacetyl]amino]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-3-yl]acetamide (PubChem CID 18527197) has the molecular formula C17H20N6O4+2 and a molecular weight of 372.39 g/mol. Its IUPAC name is (2E)-2-hydroxyimino-N-[1-[3-[3-[[(2E)-2-hydroxyiminoacetyl]amino]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-3-yl]acetamide.
| Compound Name | (2E)-2-hydroxyimino-N-[1-[3-[3-[[(2E)-2-hydroxyiminoacetyl]amino]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-3-yl]acetamide |
|---|---|
| PubChem CID | 18527197 |
| Molecular Formula | C17H20N6O4+2 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (2E)-2-hydroxyimino-N-[1-[3-[3-[[(2E)-2-hydroxyiminoacetyl]amino]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-3-yl]acetamide |
| SMILES | O=C(/C=N/O)Nc1ccc[n+](CCC[n+]2cccc(NC(=O)/C=N/O)c2)c1 |
| InChI | InChI=1S/C17H18N6O4/c24-16(10-18-26)20-14-4-1-6-22(12-14)8-3-9-23-7-2-5-15(13-23)21-17(25)11-19-27/h1-2,4-7,10-13H,3,8-9H2,(H2-2,20,21,24,25,26,27)/p+2 |
| InChIKey | BWGWZHHGOKOHGO-UHFFFAOYSA-P |
| XLogP | 0.15 |
| TPSA | 131.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|