C14H22NO4+ — CID 70451642
1-[4-(1-methoxypropoxy)butyl]pyridin-1-ium-3-carboxylic acid (PubChem CID 70451642) has the molecular formula C14H22NO4+ and a molecular weight of 268.33 g/mol. Its IUPAC name is 1-[4-(1-methoxypropoxy)butyl]pyridin-1-ium-3-carboxylic acid.
| Compound Name | 1-[4-(1-methoxypropoxy)butyl]pyridin-1-ium-3-carboxylic acid |
|---|---|
| PubChem CID | 70451642 |
| Molecular Formula | C14H22NO4+ |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 1-[4-(1-methoxypropoxy)butyl]pyridin-1-ium-3-carboxylic acid |
| SMILES | CCC(OC)OCCCC[n+]1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C14H21NO4/c1-3-13(18-2)19-10-5-4-8-15-9-6-7-12(11-15)14(16)17/h6-7,9,11,13H,3-5,8,10H2,1-2H3/p+1 |
| InChIKey | FAHOSFBESUEMHE-UHFFFAOYSA-O |
| XLogP | 1.85 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|