C8H10F6N3O2P — CID 139198210
1-(2-amino-2-oxoethyl)pyridin-1-ium-4-carboxamide hexafluorophosphate (PubChem CID 139198210) has the molecular formula C8H10F6N3O2P and a molecular weight of 325.15 g/mol. Its IUPAC name is 1-(2-amino-2-oxoethyl)pyridin-1-ium-4-carboxamide hexafluorophosphate.
| Compound Name | 1-(2-amino-2-oxoethyl)pyridin-1-ium-4-carboxamide hexafluorophosphate |
|---|---|
| PubChem CID | 139198210 |
| Molecular Formula | C8H10F6N3O2P |
| Molecular Weight | 325.15 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 1-(2-amino-2-oxoethyl)pyridin-1-ium-4-carboxamide hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.NC(=O)C[n+]1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C8H9N3O2.F6P/c9-7(12)5-11-3-1-6(2-4-11)8(10)13;1-7(2,3,4,5)6/h1-4H,5H2,(H3-,9,10,12,13);/q;-1/p+1 |
| InChIKey | MFYCABOPAIMRIG-UHFFFAOYSA-O |
| XLogP | 1.94 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.15 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|